CAS 99583-29-6

1-(3,4-Dihydro-2H-pyrrol-5-yl)ethanone

Description:

1-(3,4-Dihydro-2H-pyrrol-5-yl)ethanone, with the CAS number 99583-29-6, is an organic compound characterized by its unique structure, which includes a pyrrole ring fused with a carbonyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its potential applications in organic synthesis and medicinal chemistry, particularly as an intermediate in the synthesis of various pharmaceuticals. The presence of the pyrrole moiety contributes to its reactivity, allowing it to participate in various chemical reactions, such as nucleophilic substitutions and cycloadditions. Additionally, the compound may exhibit biological activity, making it of interest in drug discovery and development. Its solubility in organic solvents and moderate stability under standard laboratory conditions are also notable characteristics. As with many organic compounds, safety precautions should be observed when handling it, as it may pose health risks if ingested or inhaled.

Formula: C₆H₉NO

InChI: InChI=1/C6H9NO/c1-5(8)6-3-2-4-7-6/h2-4H2,1H3

SMILES: CC(=O)C1=NCCC1

Synonyms:

• 1-(3,4-Dihydro-2H-pyrrol-5-yl)ethanon
• ethanone, 1-(3,4-dihydro-2H-pyrrol-5-yl)-

1-(3,4-Dihydro-2H-pyrrol-2-yl)ethanone

Controlled Product

CAS: 99583-29-6

Formula: C₆H₉NO

Color and Shape: Neat

Molecular weight: 111.142

Ref: TR-D679525