CymitQuimica logo

CAS 99583-29-6

:

1-(3,4-Dihydro-2H-pyrrol-5-yl)ethanone

Description:
1-(3,4-Dihydro-2H-pyrrol-5-yl)ethanone, with the CAS number 99583-29-6, is an organic compound characterized by its unique structure, which includes a pyrrole ring fused with a carbonyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its potential applications in organic synthesis and medicinal chemistry, particularly as an intermediate in the synthesis of various pharmaceuticals. The presence of the pyrrole moiety contributes to its reactivity, allowing it to participate in various chemical reactions, such as nucleophilic substitutions and cycloadditions. Additionally, the compound may exhibit biological activity, making it of interest in drug discovery and development. Its solubility in organic solvents and moderate stability under standard laboratory conditions are also notable characteristics. As with many organic compounds, safety precautions should be observed when handling it, as it may pose health risks if ingested or inhaled.
Formula:C6H9NO
InChI:InChI=1/C6H9NO/c1-5(8)6-3-2-4-7-6/h2-4H2,1H3
SMILES:CC(=O)C1=NCCC1
Synonyms:
  • 1-(3,4-Dihydro-2H-pyrrol-5-yl)ethanon
  • ethanone, 1-(3,4-dihydro-2H-pyrrol-5-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.