CAS 99585-01-0
:5-Chlorohexanoyl chloride
Description:
5-Chlorohexanoyl chloride is an acyl chloride characterized by its reactive carbonyl group attached to a hexane chain with a chlorine substituent at the fifth carbon position. This compound typically appears as a colorless to pale yellow liquid and is known for its pungent odor, which is common among acyl chlorides due to the presence of the reactive carbonyl group. It is highly reactive, particularly with water, alcohols, and amines, leading to the formation of corresponding acids, esters, and amides, respectively. This reactivity makes it a valuable intermediate in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals. Additionally, 5-chlorohexanoyl chloride is sensitive to moisture and should be handled under anhydrous conditions to prevent hydrolysis. Safety precautions are essential when working with this compound, as it can cause severe irritation to the skin, eyes, and respiratory system. Proper storage in a cool, dry place, away from incompatible substances, is crucial to maintain its stability and reactivity.
Formula:C6H10Cl2O
InChI:InChI=1S/C6H10Cl2O/c1-5(7)3-2-4-6(8)9/h5H,2-4H2,1H3
InChI key:InChIKey=XOMSOSIRNGNUSH-UHFFFAOYSA-N
SMILES:C(CC(C)Cl)CC(Cl)=O
Synonyms:- Hexanoyl chloride, 5-chloro-
- 5-Chlorohexanoyl chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
5-Chlorohexanoyl chloride
CAS:5-Chlorohexanoyl chlorideFormula:C6H10Cl2OPurity:93%Molecular weight:169.055-Chlorohexanoyl Chloride
CAS:5-Chlorohexanoyl ChlorideFormula:C6H10Cl2OPurity:98%Color and Shape:LiquidMolecular weight:169.055-Chlorohexanoyl chloride
CAS:Formula:C6H10Cl2OPurity:93%Color and Shape:LiquidMolecular weight:169.0490Apixaban Impurity 122
CAS:Formula:C26H28ClN5O4Color and Shape:Colorless LiquidMolecular weight:509.995-Chlorohexanoyl Chloride
CAS:Controlled ProductApplications 5-Chloro-hexanoyl Chloride is an impurity of 5-chlorovaleroyl chloride.
References Tang, L., et al.: J. Pharm. Biomed. Anal., 53, 309 (2010)Formula:C6H10Cl2OColor and Shape:NeatMolecular weight:169.055-Chlorohexanoyl chloride
CAS:5-Chlorohexanoyl chloride is a useful organic compound for research related to life sciences. The catalog number is T64515 and the CAS number is 99585-01-0.Formula:C6H10Cl2OColor and Shape:SolidMolecular weight:169.049







