CymitQuimica logo

CAS 99585-10-1

:

3-chloro-4-ethoxybenzaldehyde

Description:
3-Chloro-4-ethoxybenzaldehyde is an organic compound characterized by its aromatic structure, featuring a benzaldehyde functional group with a chlorine atom and an ethoxy group attached to the benzene ring. The presence of the chlorine atom at the meta position relative to the aldehyde group and the ethoxy group at the para position influences its reactivity and physical properties. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic ethoxy group. 3-Chloro-4-ethoxybenzaldehyde can participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, making it useful in organic synthesis, particularly in the preparation of pharmaceuticals and agrochemicals. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested, and appropriate protective equipment should be used.
Formula:C9H9ClO2
InChI:InChI=1/C9H9ClO2/c1-2-12-9-4-3-7(6-11)5-8(9)10/h3-6H,2H2,1H3
InChI key:ZYDPBMFCTQAEMR-UHFFFAOYSA-N
SMILES:CCOc1ccc(cc1Cl)C=O
Found 4 products.