CymitQuimica logo

CAS 99585-14-5

:

Benzoic acid,2-chloro-6-methyl-, methyl ester

Description:
Benzoic acid, 2-chloro-6-methyl-, methyl ester, with the CAS number 99585-14-5, is an organic compound that belongs to the class of benzoate esters. It features a benzoic acid core substituted with a chlorine atom at the 2-position and a methyl group at the 6-position, with a methoxy group (-OCH3) indicating its ester functionality. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is characterized by its aromatic structure, which contributes to its relatively low solubility in water but good solubility in organic solvents. The presence of the chlorine atom can impart unique reactivity, making it useful in various chemical syntheses and applications. Additionally, benzoic acid derivatives are often studied for their antimicrobial properties and potential use as preservatives in food and cosmetic formulations. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C9H9ClO2
InChI:InChI=1S/C9H9ClO2/c1-6-4-3-5-7(10)8(6)9(11)12-2/h3-5H,1-2H3
InChI key:RYUYMMGUQYRLQX-UHFFFAOYSA-N
SMILES:CC1=C(C(=CC=C1)Cl)C(=O)OC
Synonyms:
  • o-Toluicacid, 6-chloro-, methyl ester (6CI)
  • 2-Chloro-6-methylbenzoic acid methylester
  • Methyl 2-chloro-6-methylbenzoate
Found 4 products.