CymitQuimica logo

CAS 99585-16-7

:

3-[(2-chlorophenyl)sulfanyl]propanoate

Description:
3-[(2-Chlorophenyl)sulfanyl]propanoate, with the CAS number 99585-16-7, is an organic compound characterized by the presence of a propanoate group attached to a sulfur atom that is further bonded to a 2-chlorophenyl group. This compound features a propanoate moiety, which is an ester derived from propanoic acid, indicating it has potential applications in organic synthesis and medicinal chemistry. The presence of the chlorophenyl group suggests that it may exhibit interesting electronic properties and biological activity, potentially influencing its reactivity and interactions with biological targets. The sulfur atom in the structure can impart unique characteristics, such as increased nucleophilicity or the ability to participate in various chemical reactions, including substitution and addition reactions. Overall, the compound's structure suggests it may be of interest in the development of pharmaceuticals or agrochemicals, although specific applications would depend on further research into its properties and behavior in various chemical environments.
Formula:C9H8ClO2S
InChI:InChI=1/C9H9ClO2S/c10-7-3-1-2-4-8(7)13-6-5-9(11)12/h1-4H,5-6H2,(H,11,12)/p-1
InChI key:NYUNDDKGPQCWPL-UHFFFAOYSA-N
SMILES:c1ccc(c(c1)Cl)SCCC(=O)[O-]
Found 4 products.