CAS 996-70-3
:1,1,2,2-Ethenetetramine, N1,N1,N1′,N1′,N2,N2,N2′,N2′-octamethyl-
Description:
1,1,2,2-Ethenetetramine, N1,N1,N1′,N1′,N2,N2,N2′,N2′-octamethyl- (CAS 996-70-3) is a synthetic organic compound characterized by its complex structure featuring multiple methyl groups attached to a central ethenetetramine framework. This compound is typically a colorless to pale yellow solid and is soluble in organic solvents. It exhibits basic properties due to the presence of amine functional groups, which can participate in various chemical reactions, including nucleophilic substitutions and polymerization processes. The presence of multiple methyl groups enhances its steric hindrance, potentially influencing its reactivity and interactions with other molecules. Additionally, this compound may have applications in materials science, particularly in the development of polymers or as a precursor in organic synthesis. Safety data indicates that, like many amines, it should be handled with care due to potential irritant properties and the need for appropriate safety measures during handling and storage.
Formula:C10H24N4
InChI:InChI=1S/C10H24N4/c1-11(2)9(12(3)4)10(13(5)6)14(7)8/h1-8H3
InChI key:InChIKey=CBXRMKZFYQISIV-UHFFFAOYSA-N
SMILES:C(=C(N(C)C)N(C)C)(N(C)C)N(C)C
Synonyms:- TMAE
- Tetrakis(dimethylamino)ethylene
- Ethenetetramine, octamethyl-
- Tetrakis(dimethylamine)ethylene
- 1,1,2,2-Ethenetetramine, N1,N1,N1′,N1′,N2,N2,N2′,N2′-octamethyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Tetrakis(dimethylamino)ethylene
CAS:Formula:C10H24N4Purity:>95.0%(GC)Color and Shape:Light yellow to Yellow to Orange clear liquidMolecular weight:200.33Tetrakis(dimethylamino)ethylene
CAS:Formula:C10H24N4Purity:85%Color and Shape:LiquidMolecular weight:200.3244N1,N1,N'1,N'1,N2,N2,N'2,N'2-Octamethylethene-1,1,2,2-Tetraamine
CAS:N1,N1,N'1,N'1,N2,N2,N'2,N'2-Octamethylethene-1,1,2,2-TetraamineFormula:C10H24N4Purity:85%Molecular weight:200.32Tetrakis(dimethylamino)ethylene
CAS:Tetrakis(dimethylamino)ethylene is a molecule that contains a benzyl group and four nitrogen atoms. It has been shown to be an excellent cell marker, which can be used as a nuclear dye in electron microscopy. Tetrakis(dimethylamino)ethylene has also been used in kinetic studies of the transfer reactions of fatty acids. The molecule is synthesized by reacting phosphorus pentoxide with light emission and thermal decomposition of hydroxyl groups. Tetrakis(dimethylamino)ethylene is shown to ionize easily, making it an ideal candidate for structural analysis. The activation energies for the reaction have been found to be between 24-25 kcal/mol.Formula:C10H24N4Purity:Min. 95%Color and Shape:Colorless PowderMolecular weight:200.32 g/mol




