CAS 99624-27-8
:(2S)-2',2'-dimethyl-7'-(3-methylbut-2-en-1-yl)-3,4-dihydro-2H,2'H-2,6'-bichromene-7,8'-diol
Description:
The chemical substance known as (2S)-2',2'-dimethyl-7'-(3-methylbut-2-en-1-yl)-3,4-dihydro-2H,2'H-2,6'-bichromene-7,8'-diol, with the CAS number 99624-27-8, is a complex organic compound characterized by its unique bicyclic structure, which includes chromene moieties. This compound features multiple chiral centers, contributing to its stereochemistry and potential biological activity. The presence of hydroxyl groups (diol) suggests that it may exhibit hydrogen bonding capabilities, influencing its solubility and reactivity. The alkyl substituents, particularly the 3-methylbut-2-en-1-yl group, may impart additional hydrophobic characteristics, affecting its interaction with biological membranes. Such compounds are often studied for their potential pharmacological properties, including antioxidant and anti-inflammatory activities. The intricate arrangement of functional groups and stereochemistry makes this substance of interest in fields such as medicinal chemistry and natural product synthesis. Further research is necessary to fully elucidate its properties and potential applications.
Formula:C25H28O4
InChI:InChI=1/C25H28O4/c1-15(2)5-9-19-20(13-17-11-12-25(3,4)29-24(17)23(19)27)21-10-7-16-6-8-18(26)14-22(16)28-21/h5-6,8,11-14,21,26-27H,7,9-10H2,1-4H3/t21-/m0/s1
SMILES:CC(=CCc1c(cc2C=CC(C)(C)Oc2c1O)[C@@H]1CCc2ccc(cc2O1)O)C
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Kazinol B
CAS:Kazinol B is an inhibitor of nitric oxide (NO) production, an isopentenylated flavan with a dimethylpyran ring.Kazinol B improves insulin sensitivity byFormula:C25H28O4Purity:98%Color and Shape:SolidMolecular weight:392.49Kazinol B
CAS:Kazinol B is an isoprenylated flavonoid, which is a secondary metabolite derived from plants, predominantly found in members of the Moraceae family. It is synthesized through the plant's natural biochemical pathways, involving the modification of basic flavonoid structures via prenylation, resulting in increased lipophilicity and potential bioactivity.
Formula:C25H28O4Purity:Min. 95%Molecular weight:392.49 g/mol





