CymitQuimica logo

CAS 99655-68-2

:

3-bromo-1-(phenylsulfonyl)-1H-indole

Description:
3-Bromo-1-(phenylsulfonyl)-1H-indole is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a bromine atom at the 3-position and a phenylsulfonyl group at the 1-position contributes to its reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its sulfonyl group can participate in various chemical reactions, making it a useful intermediate in the synthesis of pharmaceuticals and agrochemicals. The bromine substituent can also serve as a site for further functionalization, enhancing its versatility in organic synthesis. Additionally, compounds like this one are often studied for their biological activity, including potential anti-cancer properties, due to the indole moiety's presence, which is known for its role in various biological processes. Safety and handling precautions should be observed, as with many halogenated and sulfonyl-containing compounds.
Formula:C14H10BrNO2S
InChI:InChI=1/C14H10BrNO2S/c15-13-10-16(14-9-5-4-8-12(13)14)19(17,18)11-6-2-1-3-7-11/h1-10H
InChI key:MXPFKHHDXIJNDX-UHFFFAOYSA-N
SMILES:c1ccc(cc1)S(=O)(=O)n1cc(c2ccccc12)Br
Synonyms:
  • 1-(penzenesulphonyl)-3-bromo-1H-indole
Found 5 products.