CymitQuimica logo

CAS 99661-02-6

:

1-(3-bromobenzofuran-2-yl)ethanone

Description:
1-(3-Bromobenzofuran-2-yl)ethanone, with the CAS number 99661-02-6, is an organic compound characterized by its unique structure that combines a benzofuran moiety with a bromine substituent and an ethanone functional group. This compound typically exhibits a molecular formula that reflects its complex structure, which includes both aromatic and carbonyl functionalities. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitutions. The benzofuran ring contributes to its aromatic stability and may influence its solubility and interaction with biological systems. Additionally, compounds of this nature are often studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The physical properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Overall, 1-(3-bromobenzofuran-2-yl)ethanone represents a versatile structure in organic chemistry with implications in various fields.
Formula:C10H7BrO2
InChI:InChI=1/C10H7BrO2/c1-6(12)10-9(11)7-4-2-3-5-8(7)13-10/h2-5H,1H3
SMILES:CC(=O)c1c(c2ccccc2o1)Br
Synonyms:
  • 1-(3-Bromo-1-benzofuran-2-yl)ethanone
  • Ethanone, 1-(3-Bromo-2-Benzofuranyl)-
  • 1-(3-bromo-1-benzofuran-2-yl)ethan-1-one
  • 1-(3-bromo-1-benzofuran-2-yl)-1-ethanone
Found 1 products.