CymitQuimica logo

CAS 99688-42-3

:

2,5,8,11,14-Pentaoxahexadecan-16-ol, 1-phenyl-, hydrogen phosphate, compd. with morpholine (1:1)

Description:
2,5,8,11,14-Pentaoxahexadecan-16-ol, 1-phenyl-, hydrogen phosphate, compound with morpholine (1:1) is a complex organic compound characterized by its unique structure that includes a long-chain polyether backbone and a phosphate group. The presence of multiple ether linkages contributes to its solubility in polar solvents, while the phenyl group may enhance its hydrophobic interactions. The morpholine component introduces basic properties, potentially affecting the compound's reactivity and interaction with biological systems. This compound may exhibit surfactant properties due to its amphiphilic nature, making it useful in various applications, including pharmaceuticals and materials science. Its molecular structure suggests potential for forming hydrogen bonds, which can influence its physical properties such as melting point and boiling point. Additionally, the compound's stability and reactivity can be influenced by the presence of the phosphate group, which may participate in various chemical reactions. Overall, this compound's characteristics make it a subject of interest in both synthetic chemistry and potential applications in drug delivery or as a functional material.
Formula:C34H55O14P·C4H9NO
InChI:InChI=1S/C34H55O14P.C4H9NO/c35-49(36,47-29-27-43-21-19-39-13-11-37-15-17-41-23-25-45-31-33-7-3-1-4-8-33)48-30-28-44-22-20-40-14-12-38-16-18-42-24-26-46-32-34-9-5-2-6-10-34;1-3-6-4-2-5-1/h1-10H,11-32H2,(H,35,36);5H,1-4H2
InChI key:InChIKey=IBPZMFPHIBFRKT-UHFFFAOYSA-N
SMILES:C(OCCOCCOCCOCCOCCOP(OCCOCCOCCOCCOCCOCC1=CC=CC=C1)(=O)O)C2=CC=CC=C2.C1COCCN1
Synonyms:
  • 2,5,8,11,14-Pentaoxahexadecan-16-ol, 1-phenyl-, hydrogen phosphate, compd. with morpholine (1:1)
  • Morpholine, compd. with 1-phenyl-2,5,8,11,14-pentaoxahexadecan-16-yl hydrogen phosphate (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.