CymitQuimica logo

CAS 997-69-3

:

3-Butyl-2-heptanone

Description:
3-Butyl-2-heptanone, with the CAS number 997-69-3, is a ketone characterized by its seven-carbon chain and a butyl group attached to the third carbon of the heptanone structure. This compound typically appears as a colorless to pale yellow liquid with a distinctive odor. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. The presence of the ketone functional group contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic additions. 3-Butyl-2-heptanone is often used in the synthesis of other organic compounds and may serve as a flavoring agent or fragrance in certain applications. Its physical properties, such as boiling point and density, are influenced by its molecular structure, which includes both aliphatic and functional groups. As with many organic solvents, proper handling and safety precautions are essential due to potential health hazards associated with inhalation or skin contact.
Formula:C11H22O
InChI:InChI=1S/C11H22O/c1-4-6-8-11(10(3)12)9-7-5-2/h11H,4-9H2,1-3H3
InChI key:InChIKey=JTBWYOMMEUSFLO-UHFFFAOYSA-N
SMILES:C(CCCC)(CCCC)C(C)=O
Synonyms:
  • 2-Heptanone, 3-butyl-
  • 3-Butyl-2-heptanone
  • NSC 92386
  • 3-Butylheptan-2-one
Found 2 products.