CAS 99705-50-7
:Ethanone, 1-[3-(trifluoromethyl)phenyl]-, oxime
Description:
Ethanone, 1-[3-(trifluoromethyl)phenyl]-, oxime, also known by its CAS number 99705-50-7, is an organic compound characterized by the presence of a ketone functional group and an oxime functional group. This compound features a trifluoromethyl group attached to a phenyl ring, which significantly influences its chemical properties, including increased lipophilicity and potential biological activity. The oxime functional group, derived from the reaction of a ketone with hydroxylamine, imparts reactivity that can be exploited in various chemical reactions, such as condensation and rearrangement processes. The presence of the trifluoromethyl group often enhances the compound's stability and alters its electronic properties, making it of interest in medicinal chemistry and material science. Additionally, the compound may exhibit specific solubility characteristics, depending on the solvent used, and could participate in hydrogen bonding due to the oxime group. Overall, this compound's unique structure and functional groups make it a subject of interest for further research in various chemical applications.
Formula:C9H8F3NO
InChI:InChI=1/C9H8F3NO/c1-6(13-14)7-3-2-4-8(5-7)9(10,11)12/h2-5,14H,1H3/b13-6+
InChI key:InChIKey=QQGVWMIRCZEUBB-UHFFFAOYSA-N
SMILES:C(=NO)(C)C1=CC(C(F)(F)F)=CC=C1
Synonyms:- (1E)-1-[3-(trifluoromethyl)phenyl]ethanone oxime
- (1Z)-1-[3-(trifluoromethyl)phenyl]ethanone oxime
- 1-[3-(Trifluoromethyl)phenyl]ethanone oxime
- 3-(Trifluoromethyl)acetophenone oxime
- Ethanone, 1-[3-(trifluoromethyl)phenyl]-, oxime
- m-(Trifluoromethyl)acetophenone oxime
- 1-(Trifluormethylphenyl)ethanonoxim)
- -(Trifluoromethyl)acetophenoneOxime
- 1-[3-(trifluoromethyl)phenyl]ethan-1-one oxime
- 1-(3-(trifluoromethyl)phenyl)ethanone oxim
- (3E)-3-(N-hydroxyiMino)-1-[3-(trifluoroMethyl)phenyl]propan-1-one
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3'-(Trifluoromethyl)acetophenone oxime
CAS:3'-(Trifluoromethyl)acetophenone oximeFormula:C9H8F3NOPurity:≥95%Color and Shape:SolidMolecular weight:203.161121-(3-(Trifluoromethyl)phenyl)ethanone oxime
CAS:Formula:C9H8F3NOColor and Shape:SolidMolecular weight:203.16113'-(Trifluoromethyl)acetophenone Oxime
CAS:Controlled ProductStability Hygroscopic
Applications m-(Trifluoromethyl)acetophenone Oxime is a reactant in the synthesis of Trifloxystrobin (T778900) which is a broad-spectrum foliar fungicide used in plant protection.
References Chen, W., et al.: Huaxue Yanjiu, 25, 16 (2014); Margot, P. et al.: Bright. Crop Prot. Conf. Pest Dis., 2, 375 (1998); Karadimos, D.A. et al.: Crop Prot., 24, 23 (2005); Prom, L.K. et al.: Plant Dis., 87, 252 (2003);Formula:C9H8F3NOColor and Shape:NeatMolecular weight:203.16



