CAS 99724-21-7
:tert-butyl N-(azetidin-2-yl)-N-methyl-carbamate
Description:
Tert-butyl N-(azetidin-2-yl)-N-methyl-carbamate, identified by its CAS number 99724-21-7, is a chemical compound characterized by its carbamate functional group, which is derived from the reaction of an amine and a carbonic acid derivative. This compound features a tert-butyl group, providing steric hindrance that can influence its reactivity and solubility. The azetidine ring contributes to its cyclic structure, which can affect its biological activity and interaction with other molecules. The presence of the N-methyl group enhances its lipophilicity, potentially improving its permeability through biological membranes. Tert-butyl N-(azetidin-2-yl)-N-methyl-carbamate may exhibit specific pharmacological properties, making it of interest in medicinal chemistry and drug development. Its stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature. As with many carbamates, it may also be subject to hydrolysis under certain conditions, leading to the release of the corresponding amine and carbon dioxide.
Formula:C9H18N2O2
InChI:InChI=1/C9H18N2O2/c1-9(2,3)13-8(12)11(4)7-5-6-10-7/h7,10H,5-6H2,1-4H3
SMILES:CC(C)(C)OC(=O)N(C)C1CCN1
Synonyms:- Tert-Butyl Azetidin-2-Yl(Methyl)Carbamate
- tert-Butyl-azetidin-2-yl(methyl)carbamat
- (2-Azetidinylmethyl)-carbamic acid tert-butyl ester
- Azetidin-2-Ylmethyl-Carbamic Acid Tert-Butyl Ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(Azetidin-2-ylmethyl)carbamic acid tert-butyl ester hydrochloride
CAS:Formula:C9H18N2O2Purity:98%Color and Shape:SolidMolecular weight:186.2514Azetidin-2-ylmethyl-carbamic acid tert-butyl ester
CAS:Azetidin-2-ylmethyl-carbamic acid tert-butyl esterFormula:C9H18N2O2Purity:≥95%Color and Shape:SolidMolecular weight:186.251422-(N-BOC-AMINOMETHYL)AZETIDINE
CAS:Formula:C9H18N2O2Purity:98%Color and Shape:Solid, OilMolecular weight:186.2552-(N-Boc-aminomethyl)azetidine
CAS:Please enquire for more information about 2-(N-Boc-aminomethyl)azetidine including the price, delivery time and more detailed product information at the technical inquiry form on this page
Formula:C9H18N2O2Purity:Min. 95%Molecular weight:186.25 g/mol



