CymitQuimica logo

CAS 99725-34-5

:

2,4-dichloro-6-hydroxy-benzoic acid

Description:
2,4-Dichloro-6-hydroxybenzoic acid, with the CAS number 99725-34-5, is an aromatic compound characterized by the presence of two chlorine atoms and a hydroxyl group attached to a benzoic acid structure. This compound typically exhibits a white to off-white crystalline appearance. It is soluble in organic solvents and has limited solubility in water, which is common for many chlorinated aromatic compounds. The presence of the hydroxyl group contributes to its acidic properties, allowing it to participate in various chemical reactions, including esterification and substitution reactions. Additionally, the chlorinated substituents can influence its reactivity and biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. The compound may also exhibit antimicrobial properties, which can be relevant in agricultural applications. As with many chlorinated compounds, safety precautions should be taken when handling it due to potential toxicity and environmental concerns.
Formula:C7H4Cl2O3
InChI:InChI=1/C7H4Cl2O3/c8-3-1-4(9)6(7(11)12)5(10)2-3/h1-2,10H,(H,11,12)
InChI key:GHXWAANNBILSEF-UHFFFAOYSA-N
SMILES:c1c(cc(c(c1Cl)C(=O)O)O)Cl
Synonyms:
  • 2,4-Dichloro-6-hydroxybenzoic acid
  • Benzoic acid, 2,4-dichloro-6-hydroxy-
Found 3 products.