CymitQuimica logo

CAS 99754-06-0

:

4-chloro-2-{[(2E)-3-(4-pentylphenyl)prop-2-enoyl]amino}benzoic acid

Description:
4-Chloro-2-{[(2E)-3-(4-pentylphenyl)prop-2-enoyl]amino}benzoic acid, with the CAS number 99754-06-0, is an organic compound characterized by its complex structure, which includes a benzoic acid moiety substituted with a chloro group and an amino-acyl side chain. This compound features a conjugated system due to the presence of the prop-2-enoyl group, which can contribute to its reactivity and potential applications in organic synthesis or medicinal chemistry. The pentylphenyl substituent enhances its hydrophobic characteristics, potentially influencing its solubility and interaction with biological systems. The presence of the chloro substituent may also impart unique electronic properties, affecting the compound's reactivity and stability. Overall, this compound's structural features suggest it may exhibit interesting biological activities, making it a candidate for further research in pharmacology or material science. However, specific properties such as melting point, solubility, and biological activity would require empirical investigation for comprehensive characterization.
Formula:C21H22ClNO3
InChI:InChI=1/C21H22ClNO3/c1-2-3-4-5-15-6-8-16(9-7-15)10-13-20(24)23-19-14-17(22)11-12-18(19)21(25)26/h6-14H,2-5H2,1H3,(H,23,24)(H,25,26)/b13-10+
InChI key:MDVFITMPFHDRBZ-JLHYYAGUSA-N
SMILES:CCCCCC1=CC=C(C=C1)/C=C/C(=O)NC2=C(C=CC(=C2)Cl)C(=O)O
Found 5 products.