CymitQuimica logo

CAS 99768-19-1

:

Phenol, 2-bromo-5-methoxy-4-methyl-

Description:
Phenol, 2-bromo-5-methoxy-4-methyl- is an organic compound characterized by its phenolic structure, which includes a hydroxyl group (-OH) attached to a benzene ring. The presence of a bromine atom at the 2-position, a methoxy group (-OCH3) at the 5-position, and a methyl group (-CH3) at the 4-position contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the hydroxyl and methoxy groups, influencing its solubility in various solvents. It may also demonstrate reactivity typical of phenolic compounds, such as undergoing electrophilic substitution reactions. The bromine substituent can enhance the compound's reactivity and may also affect its biological activity, making it of interest in medicinal chemistry and materials science. Additionally, the presence of multiple substituents can lead to specific steric and electronic effects, impacting its overall stability and reactivity. As with many brominated compounds, safety considerations regarding toxicity and environmental impact should be taken into account during handling and application.
Formula:C8H9BrO2
InChI:InChI=1S/C8H9BrO2/c1-5-3-6(9)7(10)4-8(5)11-2/h3-4,10H,1-2H3
InChI key:InChIKey=PATNNNHFZNLAQQ-UHFFFAOYSA-N
SMILES:O(C)C1=C(C)C=C(Br)C(O)=C1
Synonyms:
  • p-Cresol, 2-bromo-5-methoxy-
  • 2-Bromo-5-methoxy-4-methylphenol
  • Phenol, 2-bromo-5-methoxy-4-methyl-
Found 3 products.