CymitQuimica logo

CAS 99768-67-9

:

5-Nitroquinazolin-4-ol

Description:
5-Nitroquinazolin-4-ol is a heterocyclic organic compound characterized by its quinazoline structure, which features a fused benzene and pyrimidine ring system. The presence of a nitro group at the 5-position and a hydroxyl group at the 4-position contributes to its unique chemical properties. This compound is typically a yellow to orange solid and is soluble in polar organic solvents. It exhibits potential biological activity, making it of interest in medicinal chemistry and pharmacology. The nitro group can participate in various chemical reactions, including reduction and nucleophilic substitution, while the hydroxyl group can act as a hydrogen bond donor, influencing the compound's interactions with biological targets. Additionally, 5-Nitroquinazolin-4-ol may serve as a precursor for the synthesis of other derivatives, expanding its utility in research and development. As with many nitro-containing compounds, it is essential to handle it with care due to potential toxicity and environmental considerations.
Formula:C8H5N3O3
InChI:InChI=1/C8H5N3O3/c12-8-7-5(9-4-10-8)2-1-3-6(7)11(13)14/h1-4H,(H,9,10,12)
InChI key:AGOKBMXSQJZEKF-UHFFFAOYSA-N
SMILES:c1cc2c(c(c1)N(=O)=O)c(ncn2)O
Synonyms:
  • 4-Quinazolinol, 5-nitro-
  • 5-Nitroquinazolin-4(3H)-one
Found 6 products.