CAS 99770-93-1
:2,2'-benzene-1,4-diylbis(4,4,5,5-tetramethyl-1,3,2-dioxaborolane)
Description:
2,2'-Benzene-1,4-diylbis(4,4,5,5-tetramethyl-1,3,2-dioxaborolane) is an organoboron compound characterized by its unique structure, which features a biphenyl core with two dioxaborolane groups attached. This compound is notable for its potential applications in organic synthesis and materials science, particularly in the development of boron-containing polymers and as a reagent in cross-coupling reactions. The presence of the dioxaborolane moiety enhances its reactivity and solubility in organic solvents, making it useful in various chemical transformations. Additionally, the tetramethyl substituents contribute to the compound's stability and steric hindrance, which can influence its reactivity profile. The compound is typically handled with care due to the presence of boron, which can form complexes with other nucleophiles. Overall, this substance exemplifies the versatility of boron chemistry in creating functional materials and intermediates for further chemical synthesis.
Formula:C18H28B2O4
InChI:InChI=1/C18H28B2O4/c1-15(2)16(3,4)22-19(21-15)13-9-11-14(12-10-13)20-23-17(5,6)18(7,8)24-20/h9-12H,1-8H3
SMILES:CC1(C)C(C)(C)OB(c2ccc(cc2)B2OC(C)(C)C(C)(C)O2)O1
Synonyms:- 1,4-Phenyldiboronic Acid Bis(Pinacol) Ester
- 1,4-Benzenediboronic acid dipinacol ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1,4-Benzenediboronic Acid Bis(pinacol) Ester
CAS:Formula:C18H28B2O4Purity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:330.041,4-Benzenediboronic acid bis(pinacol) ester, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C18H28B2O4Purity:97%Molecular weight:330.031,4-Benzenediboronic Acid Bis(pinacol) Ester
CAS:Formula:C18H28B2O4Purity:98%Color and Shape:SolidMolecular weight:330.0345Ref: IN-DA003F6J
1kgTo inquire250mgTo inquire1g22.00€5g28.00€10g37.00€25g65.00€50g102.00€100g157.00€250g266.00€500g665.00€5kg3,697.00€10kg7,388.00€Benzene-1,4-diboronic acid, pinacol diester
CAS:Benzene-1,4-diboronic acid, pinacol diesterFormula:C18H28B2O4Purity:98%Color and Shape:SolidMolecular weight:330.034511,4-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene
CAS:Formula:C18H28B2O4Purity:97%Color and Shape:Chunks,Crystalline Powder,Needles,PowderMolecular weight:330.04




