CymitQuimica logo

CAS 99780-97-9

:

3-Boc-Amino-Pyrrolidin-2-One

Description:
3-Boc-Amino-Pyrrolidin-2-One, with the CAS number 99780-97-9, is a chemical compound characterized by its pyrrolidinone structure, which features a five-membered ring containing both nitrogen and carbon atoms. The "Boc" (tert-butyloxycarbonyl) group is a common protecting group used in organic synthesis, particularly in the protection of amines. This compound typically exhibits properties associated with both amides and cyclic amines, including potential solubility in polar organic solvents. It is often utilized in the synthesis of various pharmaceuticals and bioactive molecules due to its ability to serve as an intermediate in peptide synthesis and other organic reactions. The presence of the Boc group enhances the stability of the amine during reactions, allowing for selective transformations. Additionally, the compound may exhibit specific reactivity patterns typical of pyrrolidinones, such as nucleophilic behavior at the nitrogen atom. Overall, 3-Boc-Amino-Pyrrolidin-2-One is a valuable building block in medicinal chemistry and organic synthesis.
Formula:C9H16N2O3
InChI:InChI=1S/C9H16N2O3/c1-9(2,3)14-8(13)11-6-4-5-10-7(6)12/h6H,4-5H2,1-3H3,(H,10,12)(H,11,13)
InChI key:DVWCHAUBYVZILO-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)NC1CCNC1=O
Found 4 products.