CAS 99785-51-0
:3'-bromo-3'-deoxythymidine
Description:
3'-Bromo-3'-deoxythymidine, also known as BrdU (Bromodeoxyuridine), is a synthetic nucleoside analog of thymidine, where a bromine atom is substituted at the 3' position of the sugar moiety. This compound is characterized by its ability to incorporate into DNA during replication, thereby serving as a useful tool in molecular biology and cancer research for studying cell proliferation. It is often used in assays to measure cell division and DNA synthesis, as it can be detected using specific antibodies. The presence of the bromine atom enhances its photochemical properties, making it suitable for various labeling techniques. In terms of solubility, BrdU is typically soluble in water and organic solvents, which facilitates its use in biological experiments. However, it is important to handle this compound with care, as it can be cytotoxic at high concentrations. Overall, 3'-bromo-3'-deoxythymidine is a valuable compound in research settings, particularly in studies involving DNA synthesis and cellular dynamics.
Formula:C10H13BrN2O4
InChI:InChI=1/C10H13BrN2O4/c1-5-3-13(10(16)12-9(5)15)8-2-6(11)7(4-14)17-8/h3,6-8,14H,2,4H2,1H3,(H,12,15,16)/t6-,7+,8+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3'-Bromo-3'-deoxythymidine
CAS:3'-Bromo-3'-deoxythymidine is a Nucleoside Derivative - Halo-nucleoside, 2',3'-Dideoxy nucleoside.Formula:C10H13BrN2O4Color and Shape:SolidMolecular weight:305.13Ref: TM-TNU1048
5mgTo inquire10mgTo inquire25mgTo inquire50mgTo inquire100mgTo inquire500mgTo inquire3’-Bromo-2’,3’-dideoxy-5-methyluridine
CAS:3’-Bromo-2’,3’-dideoxy-5-methyluridine is a nucleoside analog that is an antiviral agent. It has been shown to inhibit HIV in vitro and in animal models. It is active against HIV isolates that are resistant to other nucleoside analogs, such as zalcitabine. 3’-Bromo-2’,3’-dideoxy-5-methyluridine inhibits the viral RNA polymerase and DNA polymerase of the virus by competing with natural substrates for binding sites on these enzymes. This inhibition prevents the production of new viral RNA and DNA and can lead to a decrease in the amount of viral particles found in blood, lymphatic tissues, and cerebrospinal fluid.Purity:Min. 95%

