CAS 99796-35-7
:2-(2,4-dichlorophenoxy)propanoic acid; 4-hydroxy-3,5-diiodo-benzonitrile; 3-isopropyl-2,2-dioxo-1H-benzo[d][1,2,6]thiadiazin-4-one
Description:
The chemical substance known as 2-(2,4-dichlorophenoxy)propanoic acid; 4-hydroxy-3,5-diiodo-benzonitrile; 3-isopropyl-2,2-dioxo-1H-benzo[d][1,2,6]thiadiazin-4-one, with the CAS number 99796-35-7, is a complex organic compound characterized by multiple functional groups and a unique molecular structure. It features a dichlorophenoxy moiety, which suggests potential herbicidal properties, as compounds with similar structures are often used in agricultural applications. The presence of iodine substituents indicates possible applications in medicinal chemistry, as iodinated compounds can exhibit enhanced biological activity. Additionally, the thiadiazinone ring structure may contribute to its stability and reactivity, making it of interest in various chemical reactions. The compound's solubility, stability, and reactivity would depend on its specific molecular interactions and the environment in which it is used. Overall, this compound represents a diverse range of chemical functionalities that could be explored for various applications in agriculture and pharmaceuticals.
Formula:C26H23Cl2I2N3O7S
InChI:InChI=1/C10H12N2O3S.C9H8Cl2O3.C7H3I2NO/c1-7(2)12-10(13)8-5-3-4-6-9(8)11-16(12,14)15;1-5(9(12)13)14-8-3-2-6(10)4-7(8)11;8-5-1-4(3-10)2-6(9)7(5)11/h3-7,11H,1-2H3;2-5H,1H3,(H,12,13);1-2,11H
InChI key:VNBSIFOIBHKSJU-UHFFFAOYSA-N
SMILES:CC(C)N1C(=O)C2=CC=CC=C2NS1(=O)=O.CC(C(=O)O)OC1=C(C=C(C=C1)Cl)Cl.C1=C(C=C(C(=C1I)O)I)C#N
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2-(2,4-dichlorophenoxy)propanoic acid; 4-hydroxy-3,5-diiodo-benzonitrile; 3-isopropyl-2,2-dioxo-1h-benzo[d][1,2,6]thiadiazin-4-one
CAS:Formula:C26H23Cl2I2N3O7SMolecular weight:846.2567
