CAS 99799-09-4
:Cyclohexaneacetic acid,4-hydroxy-
Description:
Cyclohexaneacetic acid, 4-hydroxy- is an organic compound characterized by its cyclohexane ring structure with an acetic acid functional group and a hydroxyl group at the para position. This compound typically exhibits properties associated with both carboxylic acids and alcohols, including the ability to form hydrogen bonds due to the hydroxyl group, which can influence its solubility in polar solvents. The presence of the cyclohexane ring contributes to its hydrophobic characteristics, while the acetic acid moiety provides acidic properties. This compound may be utilized in various chemical syntheses and could serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its structural features suggest potential applications in materials science and organic synthesis, where the unique combination of functional groups can lead to interesting reactivity and interactions. As with many organic compounds, safety data sheets should be consulted for handling and storage guidelines, as well as potential hazards associated with its use.
Formula:C8H14O3
InChI:InChI=1S/C8H14O3/c9-7-3-1-6(2-4-7)5-8(10)11/h6-7,9H,1-5H2,(H,10,11)
InChI key:ALTAAUJNHYWOGS-UHFFFAOYSA-N
SMILES:C1CC(CCC1CC(=O)O)O
Synonyms:- 4-Hydroxycyclohexylacetic Acid
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2-(4-Hydroxycyclohexyl)acetic Acid (cis- and trans- mixture)
CAS:Formula:C8H14O3Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:158.202-(4-Hydroxycyclohexyl)acetic acid
CAS:Formula:C8H14O3Purity:95%Color and Shape:SolidMolecular weight:158.19502-(4-Hydroxycyclohexyl)acetic acid
CAS:2-(4-Hydroxycyclohexyl)acetic acidFormula:C8H14O3Purity:98%Molecular weight:158.22-(4-Hydroxycyclohexyl)acetic Acid
CAS:Controlled ProductApplications 2-(4-Hydroxycyclohexyl)acetic acid (cas# 99799-09-4) is a useful research chemical.
Formula:C8H14O3Color and Shape:NeatMolecular weight:158.22-(4-Hydroxycyclohexyl)acetic acid
CAS:2-(4-Hydroxycyclohexyl)acetic acidFormula:C8H14O3Purity:95%Molecular weight:158.22-(4-Hydroxycyclohexyl)acetic acid
CAS:Formula:C8H14O3Purity:95%Color and Shape:SolidMolecular weight:158.1972-(4-Hydroxycyclohexyl)acetic acid (cis- and trans- )
CAS:2-(4-Hydroxycyclohexyl)acetic acid (cis- and trans-) is a benzoate compound that acts as a solid catalyst in various chemical reactions. It is also classified as a histone deacetylase inhibitor, which means it can regulate gene expression and potentially have therapeutic effects on diseases such as cancer. This compound has been used in research settings to study its effects on hematopoiesis, the formation of blood cells. Additionally, it has reactive properties and can form amides, n-oxides, ester hydrochlorides, aldehydes, and other derivatives. Some studies suggest that this compound may have cytotoxic effects and could be explored for potential anti-cancer treatments. However, further research is needed to fully understand its mechanisms of action and potential applications.Formula:C8H14O3Purity:Min. 95%Molecular weight:158.19 g/mol






