
CAS 99811-53-7
:Boric acid, phenylmethyl ester
Description:
Boric acid, phenylmethyl ester, also known as benzyl borate, is an organic compound characterized by the presence of a boron atom bonded to a phenylmethyl group. This compound typically appears as a colorless to pale yellow liquid with a mild aromatic odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water. The esterification of boric acid with benzyl alcohol results in this compound, which exhibits properties typical of boron-containing esters, including potential applications in organic synthesis and as a reagent in various chemical reactions. Its structure allows for the formation of complexes with various substrates, making it useful in catalysis and as a building block in organic chemistry. Additionally, boric acid esters are known for their low toxicity and are sometimes explored for use in pharmaceuticals and agrochemicals. However, safety data should always be consulted, as with any chemical substance, to ensure proper handling and usage.
Formula:C7H8O·xUnspecified
InChI:InChI=1S/C7H9BO3/c9-8(10)11-6-7-4-2-1-3-5-7/h1-5,9-10H,6H2
InChI key:CTXKJNCPTVBAAU-UHFFFAOYSA-N
SMILES:B(O)(O)OCC1=CC=CC=C1
Synonyms:- Boric acid, phenylmethyl ester
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
