CAS 99817-27-3
:1,2,5-Oxadiazol-3-amine, 4-(4-fluorophenyl)-
Description:
1,2,5-Oxadiazol-3-amine, 4-(4-fluorophenyl)- is a chemical compound characterized by its oxadiazole ring structure, which consists of two nitrogen atoms and one oxygen atom within a five-membered ring. This compound features an amine group at the 3-position of the oxadiazole and a para-substituted fluorophenyl group at the 4-position, contributing to its potential biological activity and chemical reactivity. The presence of the fluorine atom enhances lipophilicity and may influence the compound's pharmacokinetic properties. Typically, compounds of this nature are investigated for their applications in medicinal chemistry, particularly in the development of pharmaceuticals due to their ability to interact with biological targets. The molecular structure allows for various functionalization possibilities, making it a versatile scaffold in drug design. Additionally, the compound's properties, such as solubility, stability, and reactivity, can be influenced by the substituents on the oxadiazole and phenyl rings, which are crucial for its potential applications in various chemical and biological contexts.
Formula:C8H6FN3O
InChI:InChI=1S/C8H6FN3O/c9-6-3-1-5(2-4-6)7-8(10)12-13-11-7/h1-4H,(H2,10,12)
InChI key:ZCPNLNCQHQETKZ-UHFFFAOYSA-N
SMILES:C1=CC(=CC=C1C2=NON=C2N)F
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
4-(4-Fluorophenyl)-1,2,5-oxadiazol-3-amine
CAS:4-(4-Fluorophenyl)-1,2,5-oxadiazol-3-amine
Molecular weight:179.15114g/mol


