CAS 99840-76-3

Acetamide, N-(1,2,3,4-tetrahydro-8-quinolinyl)-

Description:

Acetamide, N-(1,2,3,4-tetrahydro-8-quinolinyl)-, also known by its CAS number 99840-76-3, is a chemical compound that features a quinoline-derived structure. This substance is characterized by the presence of an acetamide functional group attached to a tetrahydroquinoline moiety, which contributes to its unique properties. Typically, compounds of this nature exhibit moderate solubility in polar solvents due to the presence of the amide group, while their hydrophobic quinoline structure may impart some lipophilicity. The compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure suggests potential interactions with biological targets, which could lead to various pharmacological effects. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and temperature, which are important considerations in both laboratory and industrial applications. Overall, N-(1,2,3,4-tetrahydro-8-quinolinyl)acetamide represents a class of compounds that may have significant implications in drug discovery and development.

Formula: C₁₁H₁₄N₂O

InChI: InChI=1S/C11H14N2O/c1-8(14)13-10-6-2-4-9-5-3-7-12-11(9)10/h2,4,6,12H,3,5,7H2,1H3,(H,13,14)

InChI key: KTHDNHNPVDWPBW-UHFFFAOYSA-N

SMILES: CC(=O)NC1=CC=CC2=C1NCCC2

n-(1,2,3,4-Tetrahydroquinolin-8-yl)acetamide

CAS: 99840-76-3

n-(1,2,3,4-Tetrahydroquinolin-8-yl)acetamide

Purity: 95%

Molecular weight: 190.2460022

Ref: 10-F665129