CymitQuimica logo

CAS 99860-35-2

:

6-(1-chloroethyl)-N-phenyl-1,3,5-triazine-2,4-diamine

Description:
6-(1-Chloroethyl)-N-phenyl-1,3,5-triazine-2,4-diamine, with the CAS number 99860-35-2, is a chemical compound that belongs to the class of triazine derivatives. This substance features a triazine ring, which is a six-membered aromatic heterocycle containing three nitrogen atoms. The presence of a chloroethyl group and a phenyl group contributes to its unique reactivity and potential applications. Typically, compounds of this nature exhibit properties such as moderate solubility in organic solvents and may possess biological activity, making them of interest in fields like agrochemicals or pharmaceuticals. The triazine structure is known for its stability and ability to participate in various chemical reactions, including nucleophilic substitutions. Additionally, the presence of amine groups can enhance its reactivity, allowing for further functionalization. Safety and handling precautions are essential when working with this compound, as it may exhibit toxicity or environmental hazards. Overall, 6-(1-chloroethyl)-N-phenyl-1,3,5-triazine-2,4-diamine is a compound of interest for its chemical properties and potential applications.
Formula:C11H12ClN5
InChI:InChI=1/C11H12ClN5/c1-7(12)9-15-10(13)17-11(16-9)14-8-5-3-2-4-6-8/h2-7H,1H3,(H3,13,14,15,16,17)
InChI key:HSOZFTGYXPQTLE-UHFFFAOYSA-N
SMILES:CC(c1nc(=N)[nH]c(=Nc2ccccc2)[nH]1)Cl
Synonyms:
  • 1,3,5-triazine-2,4-diamine, 6-(1-chloroethyl)-N~2~-phenyl-
Found 2 products.