CymitQuimica logo

CAS 99876-69-4

:

Benzenesulfonyl chloride, 2-chloro-5-methyl-

Description:
Benzenesulfonyl chloride, 2-chloro-5-methyl- is an organic compound characterized by the presence of a sulfonyl chloride functional group attached to a benzene ring that also features a chlorine atom and a methyl group at specific positions. This compound typically appears as a colorless to pale yellow liquid and is known for its strong reactivity due to the sulfonyl chloride moiety, which can participate in various chemical reactions, including nucleophilic substitutions. It is often used as a reagent in organic synthesis, particularly in the preparation of sulfonamides and other sulfonyl derivatives. The presence of the chlorine and methyl substituents can influence its reactivity and solubility in different solvents. Safety precautions are essential when handling this compound, as it can be corrosive and may release toxic gases upon reaction with water or other nucleophiles. Proper storage and handling in a well-ventilated area with appropriate personal protective equipment are recommended to mitigate risks associated with its use.
Formula:C7H6Cl2O2S
InChI:InChI=1S/C7H6Cl2O2S/c1-5-2-3-6(8)7(4-5)12(9,10)11/h2-4H,1H3
InChI key:IJUVBGAZPUZWJR-UHFFFAOYSA-N
SMILES:CC1=CC(=C(C=C1)Cl)S(=O)(=O)Cl
Found 4 products.