CAS 99891-36-8

1,4-Butanediol, 2,3-bis(methoxymethoxy)-, (2S,3S)-

Description:

1,4-Butanediol, 2,3-bis(methoxymethoxy)-, (2S,3S)-, with CAS number 99891-36-8, is a chemical compound characterized by its structure, which includes a butanediol backbone with two methoxymethoxy groups attached at the 2 and 3 positions. This compound is typically a colorless to pale yellow liquid and is soluble in water and various organic solvents, making it versatile for different applications. Its stereochemistry, indicated by the (2S,3S) designation, suggests specific spatial arrangements of its atoms, which can influence its reactivity and interaction with biological systems. The presence of methoxymethoxy groups enhances its potential as a building block in organic synthesis and may impart unique properties such as increased hydrophilicity or altered viscosity. Additionally, this compound may be utilized in the production of polymers, surfactants, or as an intermediate in the synthesis of other chemical entities. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.

Formula: C₈H₁₈O₆

InChI: InChI=1S/C8H18O6/c1-11-5-13-7(3-9)8(4-10)14-6-12-2/h7-10H,3-6H2,1-2H3/t7-,8-/m0/s1

InChI key: XVLLHXOANNRBLV-YUMQZZPRSA-N

SMILES: COCO[C@@H](CO)[C@H](CO)OCOC

(2S,3S)-2,3-BIS(METHOXYMETHOXY)BUTANE-1,4-DIOL

CAS: 99891-36-8

Formula: C₈H₁₈O₆

Purity: 90.0%

Molecular weight: 210.226

Ref: 10-F531151

1,4-Butanediol, 2,3-bis(methoxymethoxy)-, (2S,3S)-

CAS: 99891-36-8

Formula: C₈H₁₈O₆

Purity: 95%

Color and Shape: Solid

Molecular weight: 210.2249

Ref: IN-DA003W0M