CAS 99896-85-2
:Arginine-glycine-aspartic acid
Description:
Arginine-glycine-aspartic acid (often abbreviated as RGD) is a tripeptide composed of the amino acids arginine, glycine, and aspartic acid. It is recognized for its role in cell adhesion, as it serves as a key recognition sequence for integrins, which are proteins that facilitate cell-extracellular matrix interactions. RGD is commonly found in various proteins, particularly in the context of the extracellular matrix, and plays a crucial role in processes such as wound healing, tissue repair, and cellular signaling. The peptide exhibits a high affinity for integrin receptors, making it significant in biomedical applications, including drug delivery and tissue engineering. In terms of physical properties, RGD is typically a white to off-white powder, soluble in water, and stable under physiological conditions. Its biological activity and interactions are influenced by the specific conformation and environment, making it a subject of interest in research related to cell biology and therapeutic development.
Formula:C12H22N6O6
InChI:InChI=1S/C12H22N6O6/c13-6(2-1-3-16-12(14)15)10(22)17-5-8(19)18-7(11(23)24)4-9(20)21/h6-7H,1-5,13H2,(H,17,22)(H,18,19)(H,20,21)(H,23,24)(H4,14,15,16)/t6-,7-/m0/s1
InChI key:InChIKey=IYMAXBFPHPZYIK-BQBZGAKWSA-N
SMILES:[C@H](NC(CNC([C@H](CCCNC(=N)N)N)=O)=O)(CC(O)=O)C(O)=O
Synonyms:- L-Aspartic acid, L-arginylglycyl-
- L-Arginylglycyl-L-aspartic acid
- Arginylglycylaspartic acid
- Arg-Gly-Asp
- L-Aspartic acid, N-(N-L-arginylglycyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Arg-Gly-Asp
CAS:For cellular and molecular biology applicationsColor and Shape:White to off-white, PowderH-Arg-Gly-Asp-OH
CAS:The target epitope of several integrin receptors is the RGD sequence, a cell adhesion motif shared by several matrix-associated adhesive glycoproteins, such as fibronectin, vitronectin, fibrinogen, collagen type I, laminin, and von Willebrand factor.Formula:C12H22N6O6Purity:97.2%Color and Shape:White PowderMolecular weight:346.34Arginine-glycine-aspartic acid
CAS:Arginine-glycine-aspartic acidFormula:C12H22N6O6Purity:≥98%Molecular weight:346.34L-Aspartic acid, L-arginylglycyl-
CAS:Formula:C12H22N6O6Purity:98%Color and Shape:SolidMolecular weight:346.3397Arginine-glycine-aspartic acid
CAS:RGD (RGD (Arg-Gly-Asp) Peptides) (Arg-Gly-Asp) Peptides is a cell adhesion motif which can mimic cell adhesion proteins and bind to integrins.Formula:C12H22N6O6Purity:99.94%Color and Shape:SolidMolecular weight:346.34L-Arginylglycyl-L-aspartic acid trifluroacetate
CAS:Please enquire for more information about L-Arginylglycyl-L-aspartic acid trifluroacetate including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C12H22N6O6•(C2HF3O2)xPurity:Min. 95%Arg-Gly-Asp
CAS:Arg-Gly-Asp is a peptide with inhibitory properties against tumor growth. It binds to the integrin receptor and blocks the angiogenic process by inhibiting the expression of vascular endothelial growth factor (VEGF) and transforming growth factor beta (TGF-β). Arg-Gly-Asp also inhibits the proliferation of pluripotent cells, which are cells that can differentiate into any type of cell in the body, and prevents the formation of new blood vessels. This peptide has been shown to have inhibitory properties against leukemia inhibitory factor (LIF), which is a cytokine that regulates cell growth.
Formula:C12H22N6O6Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:346.34 g/mol





