CAS 999-17-7
:Acetic acid, (nitrooxy)-, ethyl ester
Description:
Acetic acid, (nitrooxy)-, ethyl ester, commonly known as ethyl nitroacetate, is an organic compound characterized by its ester functional group derived from acetic acid and nitro group substitution. It typically appears as a colorless to pale yellow liquid with a fruity odor. This compound is known for its reactivity, particularly in organic synthesis, where it serves as a versatile building block in the preparation of various chemical entities, including pharmaceuticals and agrochemicals. Ethyl nitroacetate is soluble in organic solvents and exhibits moderate polarity. Its chemical structure includes a nitrooxy group, which contributes to its unique reactivity profile, making it useful in nitration reactions and as a potential intermediate in the synthesis of more complex molecules. Safety considerations are important when handling this compound, as it may pose risks such as flammability and potential health hazards upon exposure. Proper storage and handling protocols should be followed to mitigate these risks.
Formula:C4H7NO5
InChI:InChI=1S/C4H7NO5/c1-2-9-4(6)3-10-5(7)8/h2-3H2,1H3
InChI key:PMCOPORTQICYLN-UHFFFAOYSA-N
SMILES:CCOC(=O)CO[N+](=O)[O-]
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
