CAS 99902-03-1
:2-thiophen-3-ylbenzaldehyde
Description:
2-Thiophen-3-ylbenzaldehyde, with the CAS number 99902-03-1, is an organic compound characterized by the presence of both a thiophene ring and a benzaldehyde functional group. This compound features a thiophene moiety substituted at the 3-position with a benzaldehyde group, which contributes to its aromatic properties. It typically appears as a yellow to brown liquid or solid, depending on its purity and specific conditions. The presence of the thiophene ring imparts unique electronic properties, making it of interest in various applications, including organic synthesis and materials science. The compound is likely to exhibit moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic aromatic structure. Additionally, it may participate in various chemical reactions, such as electrophilic substitutions or condensation reactions, due to the reactivity of the aldehyde group. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C11H8OS
InChI:InChI=1/C11H8OS/c12-7-9-3-1-2-4-11(9)10-5-6-13-8-10/h1-8H
SMILES:c1ccc(c(c1)C=O)c1ccsc1
Synonyms:- 2-(3-Thienyl)benzaldehyde
- Benzaldehyde, 2-(3-thienyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-(Thiophen-3-yl)benzaldehyde
CAS:Formula:C11H8OSPurity:%Color and Shape:LiquidMolecular weight:188.24562-(Thien-3-yl)benzaldehyde
CAS:2-(Thien-3-yl)benzaldehydeFormula:C11H8OSPurity:95+%Color and Shape:SolidMolecular weight:188.245622-(Thiophen-3-yl)benzaldehyde
CAS:2-(Thiophen-3-yl)benzaldehydeFormula:C11H8OSPurity:95+%Molecular weight:188.252-Thiophen-3-yl-benzaldehyde
CAS:2-Thiophen-3-yl-benzaldehyde is a research chemical with various potential applications. It has been studied for its antibiotic properties, specifically as a ribosome-inactivating agent. Additionally, it has shown interactions with glutamate and muscarinic receptors, suggesting potential therapeutic effects in neurological disorders. This compound has also demonstrated antinociceptive properties, indicating its potential as an analgesic. Furthermore, 2-Thiophen-3-yl-benzaldehyde has been investigated as an inhibitor of thymidylate synthase, an enzyme involved in DNA synthesis. Its ability to interact with saponins and nuclear components further highlights its versatility for research purposes.Formula:C11H8OSPurity:Min. 95%Molecular weight:188.24 g/mol




