CymitQuimica logo

CAS 99902-07-5

:

2-thiophen-2-ylbenzaldehyde

Description:
2-Thiophen-2-ylbenzaldehyde, with the CAS number 99902-07-5, is an organic compound characterized by the presence of both a thiophene ring and a benzaldehyde functional group. This compound features a thiophene moiety substituted at the 2-position with a benzaldehyde group, which contributes to its aromatic properties. It typically appears as a yellow to brown liquid or solid, depending on its purity and specific conditions. The compound is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to the reactivity of the aldehyde group and the electron-rich nature of the thiophene ring. Its molecular structure allows for various chemical reactions, including electrophilic substitutions and condensation reactions. Additionally, 2-thiophen-2-ylbenzaldehyde may exhibit interesting photophysical properties, making it a candidate for studies in materials science and organic electronics. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C11H8OS
InChI:InChI=1/C11H8OS/c12-8-9-4-1-2-5-10(9)11-6-3-7-13-11/h1-8H
InChI key:MWYVQGTVFMAUOH-UHFFFAOYSA-N
SMILES:c1ccc(c(c1)C=O)c1cccs1
Synonyms:
  • 2-(2-Thienyl)benzaldehyde
  • 2-Thien-2-Ylbenzaldehyde
  • Benzaldehyde, 2-(2-thienyl)-
Found 3 products.