CymitQuimica logo

CAS 99974-66-0

:

diethyl 3-hydroxycyclobutane-1,1-dicarboxylate

Description:
Diethyl 3-hydroxycyclobutane-1,1-dicarboxylate is an organic compound characterized by its unique cyclobutane ring structure, which is substituted with two carboxylate groups and a hydroxyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents such as ethanol and ether, but its solubility in water is limited due to its hydrophobic cyclobutane framework. The presence of the hydroxyl group contributes to its potential reactivity, allowing for hydrogen bonding and participation in various chemical reactions, such as esterification or condensation. Diethyl 3-hydroxycyclobutane-1,1-dicarboxylate may be utilized in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, due to its structural features that can influence biological activity. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C10H16O5
InChI:InChI=1/C10H16O5/c1-3-14-8(12)10(5-7(11)6-10)9(13)15-4-2/h7,11H,3-6H2,1-2H3
InChI key:HCVGFHCQRXXAGH-UHFFFAOYSA-N
SMILES:CCOC(=O)C1(CC(C1)O)C(=O)OCC
Synonyms:
  • 1,1-Cyclobutanedicarboxylic Acid, 3-Hydroxy-, Diethyl Ester
Found 4 products.