CymitQuimica logo

CAS 99977-36-3

:

N-cyclohexyl-5,6-dihydro-4H-1,3-thiazin-2-amine

Description:
N-cyclohexyl-5,6-dihydro-4H-1,3-thiazin-2-amine is a chemical compound characterized by its unique thiazine ring structure, which incorporates a sulfur atom and nitrogen atoms within a six-membered ring. This compound typically exhibits properties associated with heterocyclic amines, including potential basicity due to the presence of the amine group. The cyclohexyl substituent contributes to its hydrophobic characteristics, influencing its solubility in organic solvents rather than in water. The thiazine ring can participate in various chemical reactions, making it a candidate for applications in pharmaceuticals or agrochemicals. Additionally, the compound may exhibit biological activity, which is common among thiazine derivatives, potentially affecting its interaction with biological systems. Its stability, reactivity, and specific applications would depend on the conditions under which it is used, including temperature, pH, and the presence of other reactive species. Overall, N-cyclohexyl-5,6-dihydro-4H-1,3-thiazin-2-amine represents a versatile structure in organic chemistry with implications in various fields.
Formula:C10H18N2S
InChI:InChI=1/C10H18N2S/c1-2-5-9(6-3-1)12-10-11-7-4-8-13-10/h9H,1-8H2,(H,11,12)
InChI key:QOUZDUIPGBMLCY-UHFFFAOYSA-N
SMILES:C1CCC(CC1)NC1=NCCCS1
Synonyms:
  • 4H-1,3-thiazin-2-amine, N-cyclohexyl-5,6-dihydro-
  • Cyclohexyl-(5,6-dihydro-4H-[1,3]thiazin-2-yl)-amine
  • N-Cyclohexyl-5,6-dihydro-4H-1,3-thiazin-2-amine
  • [Synonyms]
Found 3 products.