CAS 10017-53-5
:Methylphenoxyacetamide
Description:
Methylphenoxyacetamide, with the CAS number 10017-53-5, is an organic compound characterized by its structure, which includes a methyl group, a phenoxy group, and an acetamide functional group. This compound typically appears as a solid or crystalline substance and is known for its moderate solubility in organic solvents. Methylphenoxyacetamide is often studied for its potential applications in pharmaceuticals and agrochemicals, particularly due to its biological activity. The presence of the phenoxy group can impart specific reactivity and interaction with biological systems, making it of interest in medicinal chemistry. Additionally, the acetamide moiety can influence the compound's polarity and hydrogen bonding capabilities, affecting its overall chemical behavior. Safety data sheets indicate that, like many organic compounds, it should be handled with care, as it may pose risks if ingested or inhaled. Overall, Methylphenoxyacetamide represents a class of compounds that can exhibit diverse chemical properties and potential applications in various fields.
Formula:C9H11NO2
InChI:InChI=1/C9H11NO2/c1-7-3-2-4-8(5-7)12-6-9(10)11/h2-5H,6H2,1H3,(H2,10,11)
SMILES:Cc1cccc(c1)OCC(=N)O
Synonyms:- 3-Methylphenoxyacetamide
- 2-(3-Methylphenoxy)Acetamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3'-Methylphenoxyacetamide
CAS:Formula:C9H11NO2Purity:>99.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:165.193'-Methylphenoxyacetamide
CAS:3'-MethylphenoxyacetamideFormula:C9H11NO2Purity:>99.0%Molecular weight:165.193'-Methylphenoxyacetamide
CAS:3'-Methylphenoxyacetamide is a chemotherapeutic agent that inhibits the growth of cancer cells. It is a glutathione S-transferase inhibitor and glutathione detoxifier. 3'-Methylphenoxyacetamide has been shown to inhibit the growth of cancer cells in vitro and in vivo, as well as to protect against oxidative stress in rats. This compound induces apoptosis by inhibiting the synthesis of proteins necessary for cell division or by preventing DNA replication.
Formula:C9H11NO2Purity:Min. 95%Molecular weight:165.19 g/mol




