CymitQuimica logo

CAS 100403-24-5

:

Deoxyribonucleic acids, fish sperm

Description:
Deoxyribonucleic acid (DNA) from fish sperm, identified by the CAS number 100403-24-5, is a nucleic acid that serves as the genetic material in many organisms, including fish. This substance is characterized by its double-helix structure, composed of two long strands of nucleotides, which include a phosphate group, a sugar (deoxyribose), and nitrogenous bases (adenine, thymine, cytosine, and guanine). Fish sperm DNA is notable for its high molecular weight and complexity, often containing a large number of genes that contribute to the organism's development and reproduction. It is typically extracted from the sperm of various fish species and can be used in molecular biology applications, such as cloning, sequencing, and genetic analysis. The stability of fish sperm DNA is enhanced by its packaging within sperm cells, which protects it from degradation. Additionally, this DNA can exhibit unique properties, such as high viscosity and solubility in aqueous solutions, making it valuable for research in genetics and biotechnology.
Formula:Unspecified
InChI:InChI=1S/C9H10FN3O3/c10-6-3-13(9(15)12-8(6)11)7-2-1-5(4-14)16-7/h1-3,5,7,14H,4H2,(H2,11,12,15)
InChI key:HSBKFSPNDWWPSL-UHFFFAOYSA-N
SMILES:C1=CC(OC1CO)N2C=C(C(=NC2=O)N)F
Synonyms:
  • Deoxyribonucleic acids, fish sperm
Found 4 products.