CAS 10045-58-6
:5-HYDROXY-5-METHYLHYDANTOIN
Description:
5-Hydroxy-5-methylhydantoin, with the CAS number 10045-58-6, is an organic compound that belongs to the hydantoin family. It is characterized by its five-membered ring structure containing both nitrogen and carbon atoms, which contributes to its unique chemical properties. This compound is typically a white to off-white crystalline solid and is soluble in water, making it useful in various applications. It exhibits stability under normal conditions but may decompose under extreme heat or acidic environments. 5-Hydroxy-5-methylhydantoin is often utilized in the synthesis of other chemical compounds and can act as a reagent in organic chemistry. Additionally, it has potential applications in pharmaceuticals and agrochemicals due to its biological activity. Its ability to form hydrogen bonds and participate in various chemical reactions makes it a versatile compound in both research and industrial settings. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C4H6N2O3
InChI:InChI=1/C4H6N2O3/c1-4(9)2(7)5-3(8)6-4/h9H,1H3,(H2,5,6,7,8)
InChI key:CNQHZBFQVYOFGD-UHFFFAOYSA-N
SMILES:CC1(C(=NC(=N1)O)O)O
Synonyms:- 2,4-Imidazolidinedione, 5-hydroxy-5-methyl-
- 5-Hydroxy-5-methyl-2,4-imidazolidinedione
- 5-Methyl-5-hydroxyhydantoin
- Hydantoin, 5-hydroxy-5-methyl-
- 5-Hydroxy-5-Methylimidazolidine-2,4-Dione
- 5-Hydroxy-5-methylhydantoin
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2,4-Imidazolidinedione,5-hydroxy-5-methyl-
CAS:2,4-Imidazolidinedione,5-hydroxy-5-methyl-Formula:C4H6N2O3Purity:97%Molecular weight:130.15-Hydroxy-5-methylhydantoin
CAS:Controlled ProductApplications 5-Hydroxy-5-methylhydantoin (cas# 10045-58-6) is a compound useful in organic synthesis.
Formula:C4H6N2O3Color and Shape:NeatMolecular weight:130.102,4-Imidazolidinedione,5-hydroxy-5-methyl-
CAS:Formula:C4H6N2O3Purity:97%Color and Shape:SolidMolecular weight:130.10205-Hydroxy-5-methylhydantoin
CAS:5-Hydroxy-5-methylhydantoin (5HMH) is a glycosylase that is used to repair damaged DNA. It reacts with the hydroxyl group of 5-methylcytosine and removes it, yielding thymine. The reaction proceeds through a nucleophilic attack on the carbon atom adjacent to the C5 methyl group. This reaction is dependent on neutral pH, uv absorption, and has been shown in vitro to be inhibited by the presence of oxidizing agents. 5HMH has been shown to remove UVB-induced damage from DNA in mammalian cells, which may lead to cancer.Formula:C4H6N2O3Purity:Min. 95%Molecular weight:130.1 g/molRef: 3D-FH24277
Discontinued product
