CAS 101769-63-5

Formula: C9H14O5

InChI: InChI=1S/C9H14O5/c1-2-14-9(13)5-3-6(10)8(12)7(11)4-5/h3,6-8,10-12H,2,4H2,1H3

InChI key: ZZJSUXLVNPETPK-UHFFFAOYSA-N

SMILES: CCOC(=O)C1=CC(C(C(C1)O)O)O

Ethyl 3,4,5-trihydroxycyclohex-1-enecarboxylate

CAS: 101769-63-5

Ethyl 3,4,5-trihydroxycyclohex-1-enecarboxylate

Formula: C₉H₁₄O₅

Purity: 95%

Molecular weight: 202.2

Ref: 54-OR1104693

Ethyl 3,4,5-trihydroxycyclohex-1-enecarboxylate

CAS: 101769-63-5

Formula: C₉H₁₄O₅

Purity: 95%

Color and Shape: Solid

Molecular weight: 202.2045

Ref: IN-DA008X5N

Shikimic Acid Ethyl Ester

Controlled Product

CAS: 101769-63-5

Formula: C₉H₁₄O₅

Color and Shape: Neat

Molecular weight: 202.2

Ref: TR-S357105

Shikimic acid ethyl ester

CAS: 101769-63-5

Shikimic acid ethyl ester is a chemical compound, which is an ethyl ester derivative of shikimic acid, commonly used in organic synthesis. Derived from shikimic acid, itself a prominent intermediate in the biosynthetic pathway of aromatic compounds in plants and microorganisms, this ester is utilized as a key starting material or intermediate in various synthetic procedures. Its mode of action primarily involves acting as a building block for the synthesis of complex molecules.

Formula: C₉H₁₄O₅

Purity: Min. 95%

Molecular weight: 202.2 g/mol

Ref: 3D-BEA76963