CAS 1020719-42-9

Formula: C14H19N5O4

InChI: InChI=1S/C14H19N5O4/c1-9(20)22-6-11(7-23-10(2)21)3-4-19-8-17-12-5-16-14(15)18-13(12)19/h5,8,11H,3-4,6-7H2,1-2H3,(H2,15,16,18)/i3D2,4D2

InChI key: GGXKWVWZWMLJEH-KHORGVISSA-N

SMILES: [2H]C([2H])(C(COC(=O)C)COC(=O)C)C([2H])([2H])N1C=NC2=CN=C(N=C21)N

Famciclovir-d4

CAS: 1020719-42-9

Formula: C₁₄H₁₅D₄N₅O₄

Molecular weight: 325.36

Ref: 4Z-F-011

Famciclovir-d4

Controlled Product

CAS: 1020719-42-9

Applications A deuterated prodrug of Penciclovir (P221500), which is used as an antiviral.
References Hodge, V.R.A., et al.: Antimicrob. Ag. Chemother., 33, 1765 (1989),

Formula: C₁₄₂H₄H₁₅N₅O₄

Color and Shape: Neat

Molecular weight: 325.36

Ref: TR-F101127

Famciclovir-d4

CAS: 1020719-42-9

Famciclovir-d4 is a deuterium-labeled antiviral nucleoside analog, which is a synthetic derivative of the guanine analog famciclovir. This compound is sourced through advanced chemical synthesis where deuterium atoms replace specific hydrogen atoms, providing an isotopic label that aids in the tracking and analysis of the pharmaceutical compound within biological systems.

Formula: C₁₄H₁₉N₅O₄

Purity: Min. 95%

Molecular weight: 325.36 g/mol

Ref: 3D-VQB71942