CAS 104723-60-6
:6-O-A-maltosyl-B-cyclodextrin hydrate
Description:
6-O-A-maltosyl-B-cyclodextrin hydrate is a modified cyclodextrin, which is a cyclic oligosaccharide composed of glucose units. This compound features a maltosyl group attached to the 6-position of the β-cyclodextrin, enhancing its solubility and complexation properties. Cyclodextrins are known for their ability to form inclusion complexes with various guest molecules, making them valuable in pharmaceutical, food, and cosmetic applications. The maltosyl substitution increases the hydrophilicity of the molecule, potentially improving its interaction with water-soluble compounds. As a hydrate, it contains water molecules in its crystalline structure, which can influence its stability and solubility. The compound is typically white to off-white in appearance and is soluble in water, with limited solubility in organic solvents. Its unique properties make it useful for drug delivery systems, enhancing the bioavailability of poorly soluble drugs, and in stabilizing volatile compounds. Overall, 6-O-A-maltosyl-B-cyclodextrin hydrate is a versatile substance with significant applications in various fields.
Formula:C54H90O45
InChI:InChI=1S/C54H90O45/c55-1-10-19(63)20(64)29(73)47(83-10)92-38-11(2-56)84-46(30(74)21(38)65)82-9-18-45-28(72)37(81)54(91-18)98-44-17(8-62)89-52(35(79)26(44)70)96-42-15(6-60)87-50(33(77)24(42)68)94-40-13(4-58)85-48(31(75)22(40)66)93-39-12(3-57)86-49(32(76)23(39)67)95-41-14(5-59)88-51(34(78)25(41)69)97-43-16(7-61)90-53(99-45)36(80)27(43)71/h10-81H,1-9H2/t10-,11-,12-,13-,14-,15-,16-,17-,18-,19-,20+,21-,22-,23-,24-,25-,26-,27-,28-,29-,30-,31-,32-,33-,34-,35-,36-,37-,38-,39-,40-,41-,42-,43-,44-,45-,46+,47-,48-,49-,50-,51-,52-,53-,54-/m1/s1
InChI key:QFSFPJHBIGWPMD-FXWIDUTLSA-N
SMILES:C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O[C@@H]2[C@H](O[C@@H]([C@@H]([C@H]2O)O)OC[C@@H]3[C@@H]4[C@@H]([C@H]([C@H](O3)O[C@@H]5[C@H](O[C@@H]([C@@H]([C@H]5O)O)O[C@@H]6[C@H](O[C@@H]([C@@H]([C@H]6O)O)O[C@@H]7[C@H](O[C@@H]([C@@H]([C@H]7O)O)O[C@@H]8[C@H](O[C@@H]([C@@H]([C@H]8O)O)O[C@@H]9[C@H](O[C@@H]([C@@H]([C@H]9O)O)O[C@@H]1[C@H](O[C@H](O4)[C@@H]([C@H]1O)O)CO)CO)CO)CO)CO)CO)O)O)CO)O)O)O)O
Synonyms:- 6-O-alpha-D-Maltosyl--cyclodextrin
- 6-O-Alpha-Maltosyl-Beta-Cyclodextrin Hydrate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
6-O-α-D-Maltosyl-β-cyclodextrin
CAS:Formula:C54H90O45Purity:98%Color and Shape:SolidMolecular weight:1459.26546-O-α-Maltosyl-β-cyclodextrin hydrate
CAS:Formula:C54H90O45Purity:≥ 97.0%Color and Shape:White to off-white powderMolecular weight:1459.27Mal-β-CD
CAS:Mal-β-CD is a cellular cholesterol modifier. It can form a soluble inclusion complex with cholesterol.Formula:C54H90O45Color and Shape:SolidMolecular weight:1459.276-O-alpha-D-Maltosyl-beta-cyclodextrin
CAS:Applications 6-O-α-D-Maltosyl-β-cyclodextrin is an additive to improve the solubility of quetiapine.
References Ogawa, N., et. al.: Chem. Pharm. Bull., 31, 809 (2013)Formula:C54H90O45Color and Shape:NeatMolecular weight:1459.266-O-a-Maltosyl-b-cyclodextrin
CAS:This beta-cyclodextrin (β-CD) derivative is a functionalized cyclic oligosaccharide composed of seven glucose units, characterized by a hydrophilic exterior and a lipophilic cavity (bigger than α-CD and smaller than γ-CDs), which allows it to encapsulate various guest molecules. This structural feature facilitates its use in multiple applications, including pharmaceuticals, food enhancement, and cosmetics. In the pharmaceutical industry, it enhances the solubility and stability of poorly water-soluble drugs, improving their bioavailability and efficacy while also masking unpleasant tastes. The food sector utilizes it as a stabilizer for flavors, colors, and nutrients, extending shelf life by protecting sensitive ingredients from degradation. In cosmetics, it serves as a complexing agent for fragrances and active components, ensuring their stability and controlled release. Its use expands to many other fields, including nanotechnology for drug delivery systems, environmental remediation for extracting organic pollutants, textiles for slow-release fragrances, and analytical chemistry for chiral separation.Formula:C54H90O45Purity:Min. 95%Color and Shape:White PowderMolecular weight:1,459.27 g/molRef: 3D-OM10049
Discontinued product





