CAS 105394-83-0: Decarboxy Ciprofloxacin
Description:Decarboxy Ciprofloxacin, with the CAS number 105394-83-0, is a derivative of the fluoroquinolone antibiotic ciprofloxacin. This compound is characterized by the removal of a carboxyl group from the ciprofloxacin structure, which may influence its pharmacological properties. Like its parent compound, Decarboxy Ciprofloxacin exhibits antibacterial activity, primarily targeting gram-negative bacteria by inhibiting bacterial DNA gyrase and topoisomerase IV, essential enzymes for bacterial DNA replication and transcription. The modification in its chemical structure can affect its solubility, stability, and overall bioactivity. Additionally, the compound may have different pharmacokinetic properties compared to ciprofloxacin, potentially impacting its absorption, distribution, metabolism, and excretion in biological systems. Research into its specific applications and efficacy is ongoing, as derivatives of established antibiotics can provide insights into overcoming resistance and enhancing therapeutic options. As with any pharmaceutical compound, safety and efficacy assessments are crucial for its potential use in clinical settings.
Formula:C16H18FN3O
InChI:InChI=1/C16H18FN3O/c17-13-9-12-14(10-15(13)19-7-4-18-5-8-19)20(11-1-2-11)6-3-16(12)21/h3,6,9-11,18H,1-2,4-5,7-8H2
- Synonyms:
- 1-Cyclopropyl-6-fluoro-7-(1-piperazinyl)-4(1H)-quinolinone
- 1-cyclopropyl-6-fluoro-7-piperazin-1-ylquinolin-4(1H)-one
