CymitQuimica logo

CAS 133210-96-5

:

3-Quinolinecarboxylic acid,7-chloro-1-cyclopropyl-1,4-dihydro-4-oxo-6-(1-piperazinyl)-

Description:
3-Quinolinecarboxylic acid, 7-chloro-1-cyclopropyl-1,4-dihydro-4-oxo-6-(1-piperazinyl)-, identified by its CAS number 133210-96-5, is a chemical compound that features a quinoline core, which is a bicyclic structure composed of a benzene ring fused to a pyridine ring. This compound exhibits a carboxylic acid functional group, contributing to its acidic properties. The presence of a chloro substituent and a cyclopropyl group enhances its structural complexity and may influence its biological activity. Additionally, the incorporation of a piperazine moiety suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The dihydro-4-oxo structure indicates that it may participate in various chemical reactions, including those typical of carbonyl compounds. Overall, this compound's unique structural features may confer specific pharmacological properties, making it a candidate for further research in drug development and therapeutic applications.
Formula:C17H18ClN3O3
InChI:InChI=1S/C17H18ClN3O3/c18-13-8-14-11(7-15(13)20-5-3-19-4-6-20)16(22)12(17(23)24)9-21(14)10-1-2-10/h7-10,19H,1-6H2,(H,23,24)
InChI key:CMKOKYODRILRKU-UHFFFAOYSA-N
SMILES:C1CC1N2C=C(C(=O)C3=CC(=C(C=C32)Cl)N4CCNCC4)C(=O)O
Found 6 products.