CAS 93107-11-0
:3-Quinolinecarboxylic acid,1-cyclopropyl-1,4-dihydro-4-oxo-7-(1-piperazinyl)-
Description:
3-Quinolinecarboxylic acid, 1-cyclopropyl-1,4-dihydro-4-oxo-7-(1-piperazinyl)-, identified by CAS number 93107-11-0, is a chemical compound that features a quinoline core, which is a bicyclic structure composed of a benzene ring fused to a pyridine ring. This compound exhibits characteristics typical of quinoline derivatives, including potential biological activity due to the presence of the piperazine moiety, which is known for its pharmacological properties. The cyclopropyl group contributes to the compound's structural diversity and may influence its interaction with biological targets. The carboxylic acid functional group can participate in hydrogen bonding and may enhance solubility in polar solvents. Overall, this compound may be of interest in medicinal chemistry for its potential therapeutic applications, particularly in the development of novel pharmaceuticals targeting various diseases. Its specific properties, such as solubility, stability, and reactivity, would depend on the surrounding conditions and the presence of other functional groups.
Formula:C17H19N3O3
InChI:InChI=1S/C17H19N3O3/c21-16-13-4-3-12(19-7-5-18-6-8-19)9-15(13)20(11-1-2-11)10-14(16)17(22)23/h3-4,9-11,18H,1-2,5-8H2,(H,22,23)
InChI key:IWQJEAWVHIBCDP-UHFFFAOYSA-N
SMILES:C1CC1N2C=C(C(=O)C3=C2C=C(C=C3)N4CCNCC4)C(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Ciprofloxacin impurity standard
CAS:Ciprofloxacin impurity standardFormula:C17H21ClFN3O4Color and Shape:Light YellowMolecular weight:385.81771-Cyclopropyl-4-oxo-7-(piperazin-1-yl)-1,4-dihydroquinoline-3-carboxylic acid
CAS:1-Cyclopropyl-4-oxo-7-(piperazin-1-yl)-1,4-dihydroquinoline-3-carboxylic acidFormula:C17H19N3O3Purity:95%Molecular weight:313.351-Cyclopropyl-4-oxo-7-(piperazin-1-yl)-1,4-dihydroquinoline-3-carboxylic Acid (Desfluoro Compound)
CAS:Controlled ProductFormula:C17H19N3O3Color and Shape:NeatMolecular weight:313.36Desfluorociprofloxacin
CAS:Controlled ProductFormula:C17H19N3O3Color and Shape:NeatMolecular weight:313.36Desfluoro ciprofloxacin hydrochloride
CAS:Fluoroquinolones are a class of antibiotics that are used to treat bacterial infections. Desfluoro ciprofloxacin hydrochloride is a fluorinated derivative of ciprofloxacin and is an ultra-fast synthetic compound. It has been shown to be more potent than the parent molecule. This drug is considered to be impure because it contains other chemical compounds, such as isomers and back-pressure products. The particle size distribution of desfluoro ciprofloxacin hydrochloride is usually very broad with diameters ranging from 5 nm to 1 micron. It can be separated by particle size in a phase liquid chromatography column because the particles have different hydrodynamic diameters. Desfluoro ciprofloxacin hydrochloride can also be separated by phase chromatography on an oligosaccharide column, which produces more efficient separation than traditional high-performance liquid chromatography (HPLC).Formula:C17H19N3O3·HClPurity:Min. 95%Color and Shape:Off-White PowderMolecular weight:349.81 g/mol







