CymitQuimica logo

CAS 115245-07-3

:

2,4,5-TRIBROMOBIPHENYL

Description:
2,4,5-Tribromobiphenyl is a chemical compound characterized by the presence of three bromine atoms attached to a biphenyl structure, specifically at the 2, 4, and 5 positions. This compound is part of a larger class of brominated biphenyls, which are known for their potential applications in flame retardants and other industrial uses. Its molecular structure contributes to its hydrophobic nature, making it less soluble in water but more soluble in organic solvents. 2,4,5-Tribromobiphenyl is of interest in environmental chemistry due to its persistence in the environment and potential bioaccumulation in living organisms. It may exhibit toxicological effects, raising concerns regarding its impact on human health and ecosystems. The compound is typically analyzed using techniques such as gas chromatography and mass spectrometry to assess its presence in environmental samples. Regulatory frameworks may apply to its use and disposal, reflecting the growing awareness of the environmental and health implications associated with brominated compounds.
Formula:C12H7Br3
InChI:InChI=1/C12H7Br3/c13-10-7-12(15)11(14)6-9(10)8-4-2-1-3-5-8/h1-7H
SMILES:c1ccc(cc1)c1cc(c(cc1Br)Br)Br
Synonyms:
  • Pbb 29
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.