CymitQuimica logo

CAS 59080-32-9

:

2,6-dibromobiphenyl

Description:
2,6-Dibromobiphenyl is an organic compound characterized by the presence of two bromine atoms attached to a biphenyl structure, specifically at the 2 and 6 positions of the phenyl rings. This compound is typically a white to light yellow solid at room temperature and is known for its relatively low solubility in water, but it is soluble in organic solvents such as acetone and chloroform. The presence of bromine atoms contributes to its chemical stability and influences its reactivity, making it a subject of interest in various chemical applications, including as an intermediate in organic synthesis and in the study of brominated flame retardants. Additionally, 2,6-dibromobiphenyl may exhibit biological activity, which necessitates careful handling due to potential environmental and health impacts. Its molecular structure and properties make it relevant in fields such as materials science and environmental chemistry, where understanding the behavior of halogenated compounds is crucial.
Formula:C12H8Br2
InChI:InChI=1/C12H8Br2/c13-10-7-4-8-11(14)12(10)9-5-2-1-3-6-9/h1-8H
InChI key:KCYUDWBWEGNDFO-UHFFFAOYSA-N
SMILES:c1ccc(cc1)c1c(cccc1Br)Br
Synonyms:
  • 1,1'-Biphenyl, 2,6-Dibromo-
  • 2,6-Dibromo-1,1'-biphenyl
  • Biphenyl, 2,6-dibromo-
  • 2,6-Dibromobiphenyl
Found 2 products.