CAS 116091-63-5: 2-Methoxy-5-(2-oxopropyl)benzenesulfonamide
Description:2-Methoxy-5-(2-oxopropyl)benzenesulfonamide is an organic compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. The structure features a methoxy group and a propanoyl moiety attached to a benzene ring, contributing to its potential biological activity. This compound is typically a white to off-white solid and is soluble in polar organic solvents. Its sulfonamide group can participate in hydrogen bonding, influencing its reactivity and interactions with biological targets. The presence of the methoxy group may enhance lipophilicity, potentially affecting its pharmacokinetic properties. As a sulfonamide derivative, it may exhibit properties similar to other compounds in this class, including antimicrobial and anti-inflammatory activities. However, specific applications and biological effects would depend on further empirical studies. Safety data should be consulted for handling and exposure guidelines, as sulfonamides can cause allergic reactions in some individuals. Overall, 2-Methoxy-5-(2-oxopropyl)benzenesulfonamide represents a compound of interest in medicinal chemistry and pharmacology.
Formula:C10H13NO4S
InChI:InChI=1S/C10H13NO4S/c1-7(12)5-8-3-4-9(15-2)10(6-8)16(11,13)14/h3-4,6H,5H2,1-2H3,(H2,11,13,14)
InChI key:InChIKey=MQQJFLHZXQRKKJ-UHFFFAOYSA-N
SMILES:O=C(C)CC1=CC=C(OC)C(=C1)S(=O)(=O)N
- Synonyms:
- 2-Methoxy-5-(2-Oxo-Propyl)Benzenesulfonamide
- 2-Methoxy-5-(2-Oxopropyl)Benzene Sulphonamide
- 2-Methoxy-5-(2-oxopropyl)benzenesulfonamide
- 5-(2-Oxopropyl)-2-Methoxy Benzene Sulphonamide
- 5-(2-Oxypropyl)-2-Methoxybenze
- 5-(2-Oxypropyl)-2-Methoxybenzene Sulphonamide
- 5-(2-Oxypropyl)-2-Methoxybenzenesulfonamide
- 5-Acetonyl-2-Methoxybenzene Sulphonamide
- 5-Acetonyl-2-methoxy-benzenesulfonamide
- 5-Acetonyl-2-methoxybenzenesulfonamide
- See more synonyms
- Benzenesulfonamide, 2-methoxy-5-(2-oxopropyl)-
