
CAS 116091-64-6
:Tamsulosin Impurity 1
Description:
Tamsulosin Impurity 1, with the CAS number 116091-64-6, is a chemical compound that is recognized as an impurity associated with the pharmaceutical drug tamsulosin, which is primarily used to treat benign prostatic hyperplasia (BPH). This impurity is characterized by its specific molecular structure, which may differ slightly from the parent compound, potentially affecting its pharmacological properties. Typically, impurities like Tamsulosin Impurity 1 are identified through techniques such as high-performance liquid chromatography (HPLC) and mass spectrometry. The presence of impurities in pharmaceutical formulations is closely monitored due to their potential impact on drug efficacy and safety. While specific physical and chemical properties such as melting point, solubility, and spectral data may vary, they are essential for understanding the behavior of the impurity in biological systems and its interaction with the active pharmaceutical ingredient. Regulatory guidelines often dictate the acceptable levels of such impurities in drug formulations to ensure patient safety and therapeutic effectiveness.
Formula:C20H28N2O5S
InChI:InChI=1S/C18H24N2O3S.ClH/c1-13(20-14(2)16-7-5-4-6-8-16)11-15-9-10-17(23-3)18(12-15)24(19,21)22;/h4-10,12-14,20H,11H2,1-3H3,(H2,19,21,22);1H/t13-,14-;/m1./s1
InChI key:CFMJSRCAZMKBMT-DTPOWOMPSA-N
SMILES:C[C@H](CC1=CC(=C(C=C1)OC)S(=O)(=O)N)N[C@H](C)C2=CC=CC=C2.Cl
Synonyms:- Tamsulosin Impurity 1 HCl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
Tamsulosin hydrochloride impurity standard
CAS:Tamsulosin hydrochloride impurity standardColor and Shape:White To Off-WhiteTamsulosin Impurity 1 HCl
CAS:Formula:C18H24N2O3S·HClColor and Shape:Off-White SolidMolecular weight:348.47 36.46R,R-2-Methoxy-5-[2-(1-phenylethylamino)-propyl] Benzene Sulfonamide Hydrochloride
CAS:Controlled ProductFormula:C18H24N2O3S·HClColor and Shape:NeatMolecular weight:384.92




