CAS 116091-63-5
:2-Methoxy-5-(2-oxopropyl)benzenesulfonamide
Description:
2-Methoxy-5-(2-oxopropyl)benzenesulfonamide is an organic compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. The structure features a methoxy group and a propanoyl moiety attached to a benzene ring, contributing to its potential biological activity. This compound is typically a white to off-white solid and is soluble in polar organic solvents. Its sulfonamide group can participate in hydrogen bonding, influencing its reactivity and interactions with biological targets. The presence of the methoxy group may enhance lipophilicity, potentially affecting its pharmacokinetic properties. As a sulfonamide derivative, it may exhibit properties similar to other compounds in this class, including antimicrobial and anti-inflammatory activities. However, specific applications and biological effects would depend on further empirical studies. Safety data should be consulted for handling and exposure guidelines, as sulfonamides can cause allergic reactions in some individuals. Overall, 2-Methoxy-5-(2-oxopropyl)benzenesulfonamide represents a compound of interest in medicinal chemistry and pharmacology.
Formula:C10H13NO4S
InChI:InChI=1S/C10H13NO4S/c1-7(12)5-8-3-4-9(15-2)10(6-8)16(11,13)14/h3-4,6H,5H2,1-2H3,(H2,11,13,14)
InChI key:InChIKey=MQQJFLHZXQRKKJ-UHFFFAOYSA-N
SMILES:S(N)(=O)(=O)C1=C(OC)C=CC(CC(C)=O)=C1
Synonyms:- 2-Methoxy-5-(2-Oxo-Propyl)Benzenesulfonamide
- 2-Methoxy-5-(2-Oxopropyl)Benzene Sulphonamide
- 2-Methoxy-5-(2-oxopropyl)benzenesulfonamide
- 5-(2-Oxopropyl)-2-Methoxy Benzene Sulphonamide
- 5-(2-Oxypropyl)-2-Methoxybenze
- 5-(2-Oxypropyl)-2-Methoxybenzene Sulphonamide
- 5-(2-Oxypropyl)-2-Methoxybenzenesulfonamide
- 5-Acetonyl-2-Methoxybenzene Sulphonamide
- 5-Acetonyl-2-methoxy-benzenesulfonamide
- 5-Acetonyl-2-methoxybenzenesulfonamide
- Benzenesulfonamide, 2-methoxy-5-(2-oxopropyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
Tamsulosin hydrochloride impurity standard
CAS:Tamsulosin hydrochloride impurity standardColor and Shape:White To Off-WhiteBenzenesulfonamide, 2-methoxy-5-(2-oxopropyl)-
CAS:Formula:C10H13NO4SPurity:98%Color and Shape:SolidMolecular weight:243.27952-Methoxy-5-(2-oxopropyl)benzenesulfonamide
CAS:2-Methoxy-5-(2-oxopropyl)benzenesulfonamideFormula:C10H13NO4SPurity:99%Molecular weight:243.285-Acetonyl-2-methoxybenzenesulfonamide
CAS:Controlled ProductFormula:C10H13NO4SColor and Shape:NeatMolecular weight:243.282-Methoxy-5-(2-oxopropyl)benzenesulfonamide
CAS:2-Methoxy-5-(2-oxopropyl)benzenesulfonamide is a metal catalyst that can be used in the synthesis of tamsulosin hydrochloride, an alpha blocker that is used to treat benign prostatic hyperplasia. It catalyzes the reaction between 2-methoxybenzenesulfonyl chloride and 3-amino-1,2,4-triazole. The industrial importance of this compound is due to its ability to be used as a catalyst for various chemical reactions.Formula:C10H13NO4SPurity:Min. 95%Color and Shape:PowderMolecular weight:243.28 g/mol5-Acetonyl-2-methoxybenzenesulfonamide
CAS:Formula:C10H13NO4SPurity:>98.0%(HPLC)(N)Color and Shape:White - Yellow Solid FormMolecular weight:243.285-Acetonyl-2-methoxybenzene sulfonamide
CAS:Formula:C10H13NO4SPurity:95.0%Color and Shape:SolidMolecular weight:243.285-Acetonyl-2-methoxybenzenesulfonamide
CAS:Controlled ProductFormula:C10H13NO4SColor and Shape:NeatMolecular weight:243.28










