CymitQuimica logo

CAS 1163135-92-9

:

15R-Bimatoprost

Description:
15R-Bimatoprost is a synthetic prostaglandin analog primarily used in ophthalmology for the treatment of glaucoma and ocular hypertension. It functions by increasing the outflow of aqueous humor, thereby reducing intraocular pressure. The compound is characterized by its ability to mimic the action of natural prostaglandins, promoting the relaxation of the ciliary muscle and enhancing fluid drainage from the eye. Structurally, it features a long hydrocarbon chain with specific functional groups that contribute to its biological activity. Bimatoprost is known for its potency and selectivity, making it effective in lowering intraocular pressure. Additionally, it has been studied for its potential effects on eyelash growth, leading to its use in cosmetic applications. The substance is typically administered as an eye drop solution and is well-tolerated, although some users may experience side effects such as ocular hyperemia or changes in eyelash pigmentation. Overall, 15R-Bimatoprost represents a significant advancement in the management of eye conditions related to elevated intraocular pressure.
Formula:C25H37NO4
InChI:InChI=1S/C25H37NO4/c1-2-26-25(30)13-9-4-3-8-12-21-22(24(29)18-23(21)28)17-16-20(27)15-14-19-10-6-5-7-11-19/h3,5-8,10-11,16-17,20-24,27-29H,2,4,9,12-15,18H2,1H3,(H,26,30)/b8-3-,17-16+/t20-,21-,22-,23+,24-/m1/s1
InChI key:AQOKCDNYWBIDND-ZPFRTTICSA-N
SMILES:CCNC(=O)CCC/C=C\C[C@H]1[C@H](C[C@H]([C@@H]1/C=C/[C@@H](CCC2=CC=CC=C2)O)O)O
Found 7 products.